CAS 1257651-06-1 is the registry number for 2–(4–Chlorophenyl)–6–methyl–1,3,6,2–dioxazaborocane–4,8–dione. Offered by: GLPBio. Available pack sizes: 1g, 25g, 5g.
2-(4-chlorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1257651-06-1) is a chemical compound with the molecular formula C11H11BClNO4 and a molecular weight of 267.47 g/mol. IUPAC name: 2-(4-chlorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: AZNGOMKOQANLLQ-UHFFFAOYSA-N.
| Molecular formula | C11H11BClNO4 |
|---|---|
| Molecular weight | 267.47 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | AZNGOMKOQANLLQ-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)