CAS 1257665-15-8 is the registry number for 2-((2,4-Dibromophenoxy)methyl)tetrahydro-2H-pyran, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[(2,4-dibromophenoxy)methyl]oxane (CAS 1257665-15-8) is a chemical compound with the molecular formula C12H14Br2O2 and a molecular weight of 350.05 g/mol. IUPAC name: 2-[(2,4-dibromophenoxy)methyl]oxane. InChIKey: IYZIDIBXMQILDD-UHFFFAOYSA-N.
| Molecular formula | C12H14Br2O2 |
|---|---|
| Molecular weight | 350.05 g/mol |
| IUPAC name | 2-[(2,4-dibromophenoxy)methyl]oxane |
| InChIKey | IYZIDIBXMQILDD-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)COC2=C(C=C(C=C2)Br)Br |
Computed by PubChem (NCBI)