Products 1257665-16-9

CAS 1257665-16-9 is the registry number for 1-(N-Boc-Piperidin-4-ylmethoxy)-3,5-dibromobenzene, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-[(3,5-dibromophenoxy)methyl]piperidine-1-carboxylate (CAS 1257665-16-9) is a chemical compound with the molecular formula C17H23Br2NO3 and a molecular weight of 449.2 g/mol. IUPAC name: tert-butyl 4-[(3,5-dibromophenoxy)methyl]piperidine-1-carboxylate. InChIKey: KFYHCQLOMWOCOI-UHFFFAOYSA-N.

Identity
Molecular formulaC17H23Br2NO3
Molecular weight449.2 g/mol
IUPAC nametert-butyl 4-[(3,5-dibromophenoxy)methyl]piperidine-1-carboxylate
InChIKeyKFYHCQLOMWOCOI-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)COC2=CC(=CC(=C2)Br)Br

Computed by PubChem (NCBI)