CAS 1257665-16-9 is the registry number for 1-(N-Boc-Piperidin-4-ylmethoxy)-3,5-dibromobenzene, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 4-[(3,5-dibromophenoxy)methyl]piperidine-1-carboxylate (CAS 1257665-16-9) is a chemical compound with the molecular formula C17H23Br2NO3 and a molecular weight of 449.2 g/mol. IUPAC name: tert-butyl 4-[(3,5-dibromophenoxy)methyl]piperidine-1-carboxylate. InChIKey: KFYHCQLOMWOCOI-UHFFFAOYSA-N.
| Molecular formula | C17H23Br2NO3 |
|---|---|
| Molecular weight | 449.2 g/mol |
| IUPAC name | tert-butyl 4-[(3,5-dibromophenoxy)methyl]piperidine-1-carboxylate |
| InChIKey | KFYHCQLOMWOCOI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)COC2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)