CAS 125775-49-7 appears in our catalog under these names: Methyl 4-(4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl)benzoate, 95%, Methyl 4-(4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl)benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate (CAS 125775-49-7) is a chemical compound with the molecular formula C13H7Cl6N3O2 and a molecular weight of 449.9 g/mol. IUPAC name: methyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate. InChIKey: USKYBFXFAZSNFB-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl6N3O2 |
|---|---|
| Molecular weight | 449.9 g/mol |
| IUPAC name | methyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate |
| InChIKey | USKYBFXFAZSNFB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=NC(=NC(=N2)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)