Products 1257854-97-9

CAS 1257854-97-9 is the registry number for (R)-2-(Morpholin-2-yl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-[(2R)-morpholin-2-yl]acetic acid (CAS 1257854-97-9) is a chemical compound with the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. IUPAC name: 2-[(2R)-morpholin-2-yl]acetic acid. InChIKey: TWCXRVFSIAWFMA-RXMQYKEDSA-N.

Identity
Molecular formulaC6H11NO3
Molecular weight145.16 g/mol
IUPAC name2-[(2R)-morpholin-2-yl]acetic acid
InChIKeyTWCXRVFSIAWFMA-RXMQYKEDSA-N
SMILESC1CO[C@@H](CN1)CC(=O)O

Computed by PubChem (NCBI)