CAS 1258326-97-4 appears in our catalog under these names: (S)-6,6'-Diiodo-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-7,7'-diol, 97%, 97%, (S)-6,6'-Diiodo-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-7,7'-diol, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5,5'-diiodo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol (CAS 1258326-97-4) is a chemical compound with the molecular formula C17H14I2O2 and a molecular weight of 504.10 g/mol. IUPAC name: 5,5'-diiodo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol. InChIKey: BYYDHNLIIVTOMR-UHFFFAOYSA-N.
| Molecular formula | C17H14I2O2 |
|---|---|
| Molecular weight | 504.10 g/mol |
| IUPAC name | 5,5'-diiodo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
| InChIKey | BYYDHNLIIVTOMR-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC3=C2C(=C(C=C3)I)O)C4=C1C=CC(=C4O)I |
Computed by PubChem (NCBI)