CAS 1258326-98-5 is the registry number for (S)–2,2',3,3'–Tetrahydro–6,6'–diphenyl–1,1'–spirobi(1H–indene)–7,7'–diol. Offered by: GLPBio. Available pack sizes: 100mg.
5,5'-diphenyl-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol (CAS 1258326-98-5) is a chemical compound with the molecular formula C29H24O2 and a molecular weight of 404.5 g/mol. IUPAC name: 5,5'-diphenyl-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol. InChIKey: KHSOMFOPCBJBMA-UHFFFAOYSA-N.
| Molecular formula | C29H24O2 |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | 5,5'-diphenyl-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
| InChIKey | KHSOMFOPCBJBMA-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC3=C2C(=C(C=C3)C4=CC=CC=C4)O)C5=C1C=CC(=C5O)C6=CC=CC=C6 |
Computed by PubChem (NCBI)