CAS 1258641-20-1 appears in our catalog under these names: 2-(1,3-Benzothiazol-2-yl)-4-fluoroaniline hydrochloride, 95%, 2-(1,3-Benzothiazol-2-yl)-4-fluoroaniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(1,3-benzothiazol-2-yl)-4-fluoroaniline;hydrochloride (CAS 1258641-20-1) is a chemical compound with the molecular formula C13H10ClFN2S and a molecular weight of 280.75 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-4-fluoroaniline;hydrochloride. InChIKey: KVTSORHCIXBEJV-UHFFFAOYSA-N.
| Molecular formula | C13H10ClFN2S |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-4-fluoroaniline;hydrochloride |
| InChIKey | KVTSORHCIXBEJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=C(C=CC(=C3)F)N.Cl |
Computed by PubChem (NCBI)