CAS 1258649-95-4 appears in our catalog under these names: Isoquinolin-7-ol hydrobromide, 95%, Isoquinolin-7-ol hydrobromide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g.
Isoquinolin-7-ol;hydrobromide (CAS 1258649-95-4) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: isoquinolin-7-ol;hydrobromide. InChIKey: MTTONOWNGHQVGR-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | isoquinolin-7-ol;hydrobromide |
| InChIKey | MTTONOWNGHQVGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN=C2)O.Br |
Computed by PubChem (NCBI)