Products 1258650-20-2
CAS 1258650-20-2 appears in our catalog under these names: 2-{3-((2-Chlorophenyl)methoxy)phenyl}acetic acid, 2-(3-[(2-Chlorophenyl)methoxy]phenyl)acetic acid, 95%, 2-{3-((2-chlorophenyl)methoxy)phenyl}acetic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 5g, 1g, 10g, 100mg.
2-[3-[(2-chlorophenyl)methoxy]phenyl]acetic acid (CAS 1258650-20-2) is a chemical compound with the molecular formula C15H13ClO3 and a molecular weight of 276.71 g/mol. IUPAC name: 2-[3-[(2-chlorophenyl)methoxy]phenyl]acetic acid. InChIKey: KTKKTWYBSNJANI-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO3 |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | 2-[3-[(2-chlorophenyl)methoxy]phenyl]acetic acid |
| InChIKey | KTKKTWYBSNJANI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC=CC(=C2)CC(=O)O)Cl |
Computed by PubChem (NCBI)