CAS 1258652-67-3 is the registry number for 4,5-Difluoroanthranlic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
4,5-difluoroanthracene-1-carboxylic acid (CAS 1258652-67-3) is a chemical compound with the molecular formula C15H8F2O2 and a molecular weight of 258.22 g/mol. IUPAC name: 4,5-difluoroanthracene-1-carboxylic acid. InChIKey: TWVLBYFTXRDBIO-UHFFFAOYSA-N.
| Molecular formula | C15H8F2O2 |
|---|---|
| Molecular weight | 258.22 g/mol |
| IUPAC name | 4,5-difluoroanthracene-1-carboxylic acid |
| InChIKey | TWVLBYFTXRDBIO-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=C(C=CC(=C3C=C2C(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)