CAS 1258939-38-6 appears in our catalog under these names: N–Boc–N–bis(PEG3–azide), N-Boc-N-bis(PEG3-azide), N-Boc-N-bis(PEG3-azide) 98%, tert-Butyl bis(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl)carbamate, 98%, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 100 mg, 250 mg, 25 mg.
Tert-butyl N,N-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]carbamate (CAS 1258939-38-6) is a chemical compound with the molecular formula C21H41N7O8 and a molecular weight of 519.6 g/mol. IUPAC name: tert-butyl N,N-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]carbamate. InChIKey: QFOPRIUYDMJUNP-UHFFFAOYSA-N.
| Molecular formula | C21H41N7O8 |
|---|---|
| Molecular weight | 519.6 g/mol |
| IUPAC name | tert-butyl N,N-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | QFOPRIUYDMJUNP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCOCCOCCOCCN=[N+]=[N-])CCOCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)