CAS 1259028-99-3 appears in our catalog under these names: BTT-3033 99%, 1-(4-Fluorophenyl)-N-methyl-N-(4-(3-phenylureido)phenyl)-1H-pyrazole-4-sulfonamide, 99%, 99%, Btt 3033, 95%, BTT 3033, BTT-3033/ 98.91% (existing batch purity). Offered by: Ambeed, Chemat, Combi-blocks, TRC, TargetMol. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 500mg, 50 mg.
1-[4-[[1-(4-fluorophenyl)pyrazol-4-yl]sulfonyl-methylamino]phenyl]-3-phenylurea (CAS 1259028-99-3) is a chemical compound with the molecular formula C23H20FN5O3S and a molecular weight of 465.5 g/mol. IUPAC name: 1-[4-[[1-(4-fluorophenyl)pyrazol-4-yl]sulfonyl-methylamino]phenyl]-3-phenylurea. InChIKey: NSLIQOPYDUKWTA-UHFFFAOYSA-N.
| Molecular formula | C23H20FN5O3S |
|---|---|
| Molecular weight | 465.5 g/mol |
| IUPAC name | 1-[4-[[1-(4-fluorophenyl)pyrazol-4-yl]sulfonyl-methylamino]phenyl]-3-phenylurea |
| InChIKey | NSLIQOPYDUKWTA-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)NC(=O)NC2=CC=CC=C2)S(=O)(=O)C3=CN(N=C3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)