CAS 1259029-47-4 is the registry number for BTT-3034. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-[methyl-[5-(2-methylpyrazol-3-yl)thiophen-2-yl]sulfonylamino]phenyl]-3-phenylurea (CAS 1259029-47-4) is a chemical compound with the molecular formula C22H21N5O3S2 and a molecular weight of 467.6 g/mol. IUPAC name: 1-[4-[methyl-[5-(2-methylpyrazol-3-yl)thiophen-2-yl]sulfonylamino]phenyl]-3-phenylurea. InChIKey: URQXSAGNGHPINO-UHFFFAOYSA-N.
| Molecular formula | C22H21N5O3S2 |
|---|---|
| Molecular weight | 467.6 g/mol |
| IUPAC name | 1-[4-[methyl-[5-(2-methylpyrazol-3-yl)thiophen-2-yl]sulfonylamino]phenyl]-3-phenylurea |
| InChIKey | URQXSAGNGHPINO-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=CC=C(S2)S(=O)(=O)N(C)C3=CC=C(C=C3)NC(=O)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)