CAS 1259033-72-1 is the registry number for Difenoconazole Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
1-[[2-[2-chloro-4-(4-chlorophenoxy)phenyl]-4-ethyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole (CAS 1259033-72-1) is a chemical compound with the molecular formula C20H19Cl2N3O3 and a molecular weight of 420.3 g/mol. IUPAC name: 1-[[2-[2-chloro-4-(4-chlorophenoxy)phenyl]-4-ethyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole. InChIKey: FFVXOZCQKGDMFL-UHFFFAOYSA-N.
| Molecular formula | C20H19Cl2N3O3 |
|---|---|
| Molecular weight | 420.3 g/mol |
| IUPAC name | 1-[[2-[2-chloro-4-(4-chlorophenoxy)phenyl]-4-ethyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
| InChIKey | FFVXOZCQKGDMFL-UHFFFAOYSA-N |
| SMILES | CCC1COC(O1)(CN2C=NC=N2)C3=C(C=C(C=C3)OC4=CC=C(C=C4)Cl)Cl |
Computed by PubChem (NCBI)