Products 1259040-07-7

CAS 1259040-07-7 is the registry number for 8-tert-Butyl 4-ethyl 2-benzyl-2,8-diazaspiro[4.5]decane-4,8-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

8-O-tert-butyl 4-O-ethyl 2-benzyl-2,8-diazaspiro[4.5]decane-4,8-dicarboxylate (CAS 1259040-07-7) is a chemical compound with the molecular formula C23H34N2O4 and a molecular weight of 402.5 g/mol. IUPAC name: 8-O-tert-butyl 4-O-ethyl 2-benzyl-2,8-diazaspiro[4.5]decane-4,8-dicarboxylate. InChIKey: HXIYZDNGGAWQGG-UHFFFAOYSA-N.

Identity
Molecular formulaC23H34N2O4
Molecular weight402.5 g/mol
IUPAC name8-O-tert-butyl 4-O-ethyl 2-benzyl-2,8-diazaspiro[4.5]decane-4,8-dicarboxylate
InChIKeyHXIYZDNGGAWQGG-UHFFFAOYSA-N
SMILESCCOC(=O)C1CN(CC12CCN(CC2)C(=O)OC(C)(C)C)CC3=CC=CC=C3

Computed by PubChem (NCBI)