Products 125905-17-1
CAS 125905-17-1 appears in our catalog under these names: (D-Pro12)-α-MSH (11-13) (free acid), (D–Pro¹²)–α–MSH (11–13) (free acid), (D-Pro12)-alpha-MSH (11-13) (free acid). Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 25mg, 50mg.
(2S)-2-[[(2R)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid (CAS 125905-17-1) is a chemical compound with the molecular formula C16H30N4O4 and a molecular weight of 342.43 g/mol. IUPAC name: (2S)-2-[[(2R)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid. InChIKey: YSPZCHGIWAQVKQ-XQQFMLRXSA-N.
| Molecular formula | C16H30N4O4 |
|---|---|
| Molecular weight | 342.43 g/mol |
| IUPAC name | (2S)-2-[[(2R)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid |
| InChIKey | YSPZCHGIWAQVKQ-XQQFMLRXSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)[C@H]1CCCN1C(=O)[C@H](CCCCN)N |
Computed by PubChem (NCBI)