Products 1259098-92-4
CAS 1259098-92-4 is the registry number for 3-[N-[5-(Dimethylcarbamoyl)-2-methylphenyl]sulfamoyl]benzoic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-[[5-(dimethylcarbamoyl)-2-methylphenyl]sulfamoyl]benzoic acid (CAS 1259098-92-4) is a chemical compound with the molecular formula C17H18N2O5S and a molecular weight of 362.4 g/mol. IUPAC name: 3-[[5-(dimethylcarbamoyl)-2-methylphenyl]sulfamoyl]benzoic acid. InChIKey: PQAFUFFMNFZKFL-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O5S |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 3-[[5-(dimethylcarbamoyl)-2-methylphenyl]sulfamoyl]benzoic acid |
| InChIKey | PQAFUFFMNFZKFL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)N(C)C)NS(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)