CAS 796083-83-5 appears in our catalog under these names: [(4-([(2,4-Dimethylphenyl)sulfonyl]amino)benzoyl)amino]acetic acid, 95%, 2-{(4-(2,4-dimethylbenzenesulfonamido)phenyl)formamido}acetic acid, 95%, 2-{(4-(2,4-Dimethylbenzenesulfonamido)phenyl)formamido}acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-[[4-[(2,4-dimethylphenyl)sulfonylamino]benzoyl]amino]acetic acid (CAS 796083-83-5) is a chemical compound with the molecular formula C17H18N2O5S and a molecular weight of 362.4 g/mol. IUPAC name: 2-[[4-[(2,4-dimethylphenyl)sulfonylamino]benzoyl]amino]acetic acid. InChIKey: BQLVEKZXBMGZFD-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O5S |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 2-[[4-[(2,4-dimethylphenyl)sulfonylamino]benzoyl]amino]acetic acid |
| InChIKey | BQLVEKZXBMGZFD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)C(=O)NCC(=O)O)C |
Computed by PubChem (NCBI)