CAS 125910-53-4 is the registry number for 4-(3,5-Dimethyl-1-adamantyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(3,5-dimethyl-1-adamantyl)phenol (CAS 125910-53-4) is a chemical compound with the molecular formula C18H24O and a molecular weight of 256.4 g/mol. IUPAC name: 4-(3,5-dimethyl-1-adamantyl)phenol. InChIKey: TWSBXJSZMPALGE-UHFFFAOYSA-N.
| Molecular formula | C18H24O |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | 4-(3,5-dimethyl-1-adamantyl)phenol |
| InChIKey | TWSBXJSZMPALGE-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)C4=CC=C(C=C4)O)C |
Computed by PubChem (NCBI)