CAS 1259130-85-2 is the registry number for 1-(3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl)-2-phenylethan-1-amine, oxalic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylethanamine;oxalic acid (CAS 1259130-85-2) is a chemical compound with the molecular formula C18H16ClN3O5 and a molecular weight of 389.8 g/mol. IUPAC name: 1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylethanamine;oxalic acid. InChIKey: FYNUDWRBKMWZRI-UHFFFAOYSA-N.
| Molecular formula | C18H16ClN3O5 |
|---|---|
| Molecular weight | 389.8 g/mol |
| IUPAC name | 1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylethanamine;oxalic acid |
| InChIKey | FYNUDWRBKMWZRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C2=NC(=NO2)C3=CC=C(C=C3)Cl)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)