CAS 1259330-61-4 appears in our catalog under these names: Sparstolonin B, 98%, Sparstolonin B/ 99.54% (existing batch purity), Sparstolonin B, Sparstolonin B, 4,10-Dihydroxy-3H-pyrano[3,4,5-kl]xanthen-3-one, 98% (HPLC), 98% (HPLC). Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 2mg, 5mg, 25mg, 50mg, 1mg, 10mg, 10mM (in 1ml dmso).
4,14-dihydroxy-8,15-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,13-heptaen-12-one (CAS 1259330-61-4) is a chemical compound with the molecular formula C15H8O5 and a molecular weight of 268.22 g/mol. IUPAC name: 4,14-dihydroxy-8,15-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,13-heptaen-12-one. InChIKey: KUPDHLFGNQEASI-UHFFFAOYSA-N.
| Molecular formula | C15H8O5 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | 4,14-dihydroxy-8,15-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,13-heptaen-12-one |
| InChIKey | KUPDHLFGNQEASI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C3=COC(=C4C3=C(O2)C=CC4=O)O |
Computed by PubChem (NCBI)