CAS 1259366-98-7 is the registry number for (1R,3S)-Ethyl 3-aminocyclohexanecarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-ethyl (1R,3S)-3-aminocyclohexane-1-carboxylate (CAS 1259366-98-7) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: cis-ethyl (1R,3S)-3-aminocyclohexane-1-carboxylate. InChIKey: VALZPPHHDRBGHU-SFYZADRCSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | cis-ethyl (1R,3S)-3-aminocyclohexane-1-carboxylate |
| InChIKey | VALZPPHHDRBGHU-SFYZADRCSA-N |
| SMILES | CCOC(=O)[C@@H]1CCC[C@@H](C1)N |
Computed by PubChem (NCBI)