CAS 125949-72-6 appears in our catalog under these names: Tazobactam Acid Impurity 21, Tazobactam Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
Benzhydryl (2S,3S,5R)-3-methyl-7-oxo-3-(triazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (CAS 125949-72-6) is a chemical compound with the molecular formula C23H22N4O3S and a molecular weight of 434.5 g/mol. IUPAC name: benzhydryl (2S,3S,5R)-3-methyl-7-oxo-3-(triazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate. InChIKey: JQBMYOWGXZWEBC-NWSQWKLXSA-N.
| Molecular formula | C23H22N4O3S |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | benzhydryl (2S,3S,5R)-3-methyl-7-oxo-3-(triazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| InChIKey | JQBMYOWGXZWEBC-NWSQWKLXSA-N |
| SMILES | C[C@@]1([C@@H](N2[C@H](S1)CC2=O)C(=O)OC(C3=CC=CC=C3)C4=CC=CC=C4)CN5C=CN=N5 |
Computed by PubChem (NCBI)