CAS 1259515-25-7 appears in our catalog under these names: 10–O–Ethylcannabitriol, 10-o-Ethylcannabitriol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
(9R,10R)-10-ethoxy-6,6,9-trimethyl-3-pentyl-8,10-dihydro-7H-benzo[c]chromene-1,9-diol (CAS 1259515-25-7) is a chemical compound with the molecular formula C23H34O4 and a molecular weight of 374.5 g/mol. IUPAC name: (9R,10R)-10-ethoxy-6,6,9-trimethyl-3-pentyl-8,10-dihydro-7H-benzo[c]chromene-1,9-diol. InChIKey: HRAUOPAWWNBNRN-FYYLOGMGSA-N.
| Molecular formula | C23H34O4 |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | (9R,10R)-10-ethoxy-6,6,9-trimethyl-3-pentyl-8,10-dihydro-7H-benzo[c]chromene-1,9-diol |
| InChIKey | HRAUOPAWWNBNRN-FYYLOGMGSA-N |
| SMILES | CCCCCC1=CC(=C2C(=C1)OC(C3=C2[C@H]([C@](CC3)(C)O)OCC)(C)C)O |
Computed by PubChem (NCBI)