CAS 1259519-20-4 is the registry number for Sutetinib, 99.27%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 25 mg, 10mM/1mL, 5 mg.
(E)-N-[3-cyano-7-ethoxy-4-(3-ethynylanilino)quinolin-6-yl]-4-(dimethylamino)but-2-enamide (CAS 1259519-20-4) is a chemical compound with the molecular formula C26H25N5O2 and a molecular weight of 439.5 g/mol. IUPAC name: (E)-N-[3-cyano-7-ethoxy-4-(3-ethynylanilino)quinolin-6-yl]-4-(dimethylamino)but-2-enamide. InChIKey: NAVJYTIRRMDRQK-DHZHZOJOSA-N.
| Molecular formula | C26H25N5O2 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (E)-N-[3-cyano-7-ethoxy-4-(3-ethynylanilino)quinolin-6-yl]-4-(dimethylamino)but-2-enamide |
| InChIKey | NAVJYTIRRMDRQK-DHZHZOJOSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)N=CC(=C2NC3=CC=CC(=C3)C#C)C#N)NC(=O)/C=C/CN(C)C |
Computed by PubChem (NCBI)