CAS 1259615-52-5 is the registry number for (R)-1-(2-Bromo-6-methoxyphenyl)ethan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(2-bromo-6-methoxyphenyl)ethanamine (CAS 1259615-52-5) is a chemical compound with the molecular formula C9H12BrNO and a molecular weight of 230.10 g/mol. IUPAC name: (1R)-1-(2-bromo-6-methoxyphenyl)ethanamine. InChIKey: MKKDUCRZIHCFQG-ZCFIWIBFSA-N.
| Molecular formula | C9H12BrNO |
|---|---|
| Molecular weight | 230.10 g/mol |
| IUPAC name | (1R)-1-(2-bromo-6-methoxyphenyl)ethanamine |
| InChIKey | MKKDUCRZIHCFQG-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=C(C=CC=C1Br)OC)N |
Computed by PubChem (NCBI)