Products 1259680-82-4
CAS 1259680-82-4 appears in our catalog under these names: trans 4-Dimethylaminocrotonic Acid-d6 Methyl Ester, Methyl (E)-4-(dimethylamino)but-2-enoate-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
Methyl (E)-4-[bis(trideuteriomethyl)amino]but-2-enoate (CAS 1259680-82-4) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 149.22 g/mol. IUPAC name: methyl (E)-4-[bis(trideuteriomethyl)amino]but-2-enoate. InChIKey: CIBYNORTVQSQMW-BDHXLSSYSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 149.22 g/mol |
| IUPAC name | methyl (E)-4-[bis(trideuteriomethyl)amino]but-2-enoate |
| InChIKey | CIBYNORTVQSQMW-BDHXLSSYSA-N |
| SMILES | [2H]C([2H])([2H])N(C/C=C/C(=O)OC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)