Products 125970-63-0
CAS 125970-63-0 is the registry number for 2-Chlorobenzoic acid-13C6. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
6-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 125970-63-0) is a chemical compound with the molecular formula C7H5ClO2 and a molecular weight of 162.52 g/mol. IUPAC name: 6-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: IKCLCGXPQILATA-IDEBNGHGSA-N.
| Molecular formula | C7H5ClO2 |
|---|---|
| Molecular weight | 162.52 g/mol |
| IUPAC name | 6-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | IKCLCGXPQILATA-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13C](=[13CH]1)C(=O)O)Cl |
Computed by PubChem (NCBI)