Products 1259781-68-4
CAS 1259781-68-4 is the registry number for (R)-(5-Bromo-4-methylpyridin-2-yl)(cyclopropyl)methanamine, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
(R)-(5-bromo-4-methyl-2-pyridinyl)-cyclopropylmethanamine (CAS 1259781-68-4) is a chemical compound with the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. IUPAC name: (R)-(5-bromo-4-methyl-2-pyridinyl)-cyclopropylmethanamine. InChIKey: TURYTQVSHKDQFN-SNVBAGLBSA-N.
| Molecular formula | C10H13BrN2 |
|---|---|
| Molecular weight | 241.13 g/mol |
| IUPAC name | (R)-(5-bromo-4-methyl-2-pyridinyl)-cyclopropylmethanamine |
| InChIKey | TURYTQVSHKDQFN-SNVBAGLBSA-N |
| SMILES | CC1=CC(=NC=C1Br)[C@@H](C2CC2)N |
Computed by PubChem (NCBI)