CAS 1259838-59-9 appears in our catalog under these names: 1-Fluoro-4-(methoxymethyl)-2-nitrobenzene, 95%, 1–Fluoro–4–(methoxymethyl)–2–nitrobenzene. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
1-fluoro-4-(methoxymethyl)-2-nitrobenzene (CAS 1259838-59-9) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 1-fluoro-4-(methoxymethyl)-2-nitrobenzene. InChIKey: KSUXYANQIKCARL-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 1-fluoro-4-(methoxymethyl)-2-nitrobenzene |
| InChIKey | KSUXYANQIKCARL-UHFFFAOYSA-N |
| SMILES | COCC1=CC(=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)