CAS 125990-78-5 is the registry number for 2,2'-(Benzo[c][1,2,5]thiadiazole-4,7-diylidene)dimalononitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(dicyanomethylidene)-2,1,3-benzothiadiazol-7-ylidene]propanedinitrile (CAS 125990-78-5) is a chemical compound with the molecular formula C12H2N6S and a molecular weight of 262.25 g/mol. IUPAC name: 2-[4-(dicyanomethylidene)-2,1,3-benzothiadiazol-7-ylidene]propanedinitrile. InChIKey: YJKTUPPCYLQBQA-UHFFFAOYSA-N.
| Molecular formula | C12H2N6S |
|---|---|
| Molecular weight | 262.25 g/mol |
| IUPAC name | 2-[4-(dicyanomethylidene)-2,1,3-benzothiadiazol-7-ylidene]propanedinitrile |
| InChIKey | YJKTUPPCYLQBQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C#N)C#N)C2=NSN=C2C1=C(C#N)C#N |
Computed by PubChem (NCBI)