Products 125992-09-8
CAS 125992-09-8 is the registry number for AHR-11797. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methyl-9-phenyl-1,10-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-11-one (CAS 125992-09-8) is a chemical compound with the molecular formula C17H14N2O and a molecular weight of 262.30 g/mol. IUPAC name: 3-methyl-9-phenyl-1,10-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-11-one. InChIKey: DVLGLHMHWBPJKX-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | 3-methyl-9-phenyl-1,10-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-11-one |
| InChIKey | DVLGLHMHWBPJKX-UHFFFAOYSA-N |
| SMILES | CC1CN2C3=C(C=CC=C13)C(=NC2=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)