Products 1259979-50-4
CAS 1259979-50-4 appears in our catalog under these names: 4-Methoxy-3-(trifluoromethoxy)-dl-phenylalanine, 95%, 2-Amino-3-(4-methoxy-3-(trifluoromethoxy)phenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-amino-3-[4-methoxy-3-(trifluoromethoxy)phenyl]propanoic acid (CAS 1259979-50-4) is a chemical compound with the molecular formula C11H12F3NO4 and a molecular weight of 279.21 g/mol. IUPAC name: 2-amino-3-[4-methoxy-3-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: RAISOBRVUKCEEC-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO4 |
|---|---|
| Molecular weight | 279.21 g/mol |
| IUPAC name | 2-amino-3-[4-methoxy-3-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | RAISOBRVUKCEEC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC(C(=O)O)N)OC(F)(F)F |
Computed by PubChem (NCBI)