CAS 1259983-03-3 is the registry number for 2-((TERT-BUTOXYCARBONYL)AMINO)-3-(3-CHLORO-4-FLUOROPHENYL)PROPANOIC ACID, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1259983-03-3) is a chemical compound with the molecular formula C14H17ClFNO4 and a molecular weight of 317.74 g/mol. IUPAC name: 3-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: WDIIAFRANWBIRL-UHFFFAOYSA-N.
| Molecular formula | C14H17ClFNO4 |
|---|---|
| Molecular weight | 317.74 g/mol |
| IUPAC name | 3-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | WDIIAFRANWBIRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC(=C(C=C1)F)Cl)C(=O)O |
Computed by PubChem (NCBI)