CAS 1259987-95-5 is the registry number for MorDalPhos AuCl 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Bis(1-adamantyl)-(2-morpholin-4-ylphenyl)phosphane;chlorogold (CAS 1259987-95-5) is a chemical compound with the molecular formula C30H42AuClNOP and a molecular weight of 696.1 g/mol. IUPAC name: bis(1-adamantyl)-(2-morpholin-4-ylphenyl)phosphane;chlorogold. InChIKey: IOHKOGDVLVOVCK-UHFFFAOYSA-M.
| Molecular formula | C30H42AuClNOP |
|---|---|
| Molecular weight | 696.1 g/mol |
| IUPAC name | bis(1-adamantyl)-(2-morpholin-4-ylphenyl)phosphane;chlorogold |
| InChIKey | IOHKOGDVLVOVCK-UHFFFAOYSA-M |
| SMILES | C1COCCN1C2=CC=CC=C2P(C34CC5CC(C3)CC(C5)C4)C67CC8CC(C6)CC(C8)C7.Cl[Au] |
Computed by PubChem (NCBI)