CAS 1259993-84-4 appears in our catalog under these names: 3-Chloro-2-fluoro-dl-phenylalanine, 95%, 2-Amino-3-(3-chloro-2-fluorophenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 250mg, 10g, 1g.
2-amino-3-(3-chloro-2-fluorophenyl)propanoic acid (CAS 1259993-84-4) is a chemical compound with the molecular formula C9H9ClFNO2 and a molecular weight of 217.62 g/mol. IUPAC name: 2-amino-3-(3-chloro-2-fluorophenyl)propanoic acid. InChIKey: LSZBXQYJHCORIE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFNO2 |
|---|---|
| Molecular weight | 217.62 g/mol |
| IUPAC name | 2-amino-3-(3-chloro-2-fluorophenyl)propanoic acid |
| InChIKey | LSZBXQYJHCORIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)