CAS 126-95-4 is the registry number for Calcium Glycerophosphate. Offered by: Chemat Brand. Available pack sizes: on request.
Calcium 2,3-dihydroxypropyl phosphate (CAS 126-95-4) is a chemical compound with the molecular formula C3H7CaO6P and a molecular weight of 210.14 g/mol. IUPAC name: calcium 2,3-dihydroxypropyl phosphate. InChIKey: IWIRHXNCFWGFJE-UHFFFAOYSA-L.
| Molecular formula | C3H7CaO6P |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | calcium 2,3-dihydroxypropyl phosphate |
| InChIKey | IWIRHXNCFWGFJE-UHFFFAOYSA-L |
| SMILES | C(C(COP(=O)([O-])[O-])O)O.[Ca+2] |
Computed by PubChem (NCBI)