Products 1260017-98-8
CAS 1260017-98-8 is the registry number for 7-Fluoro-1-oxo-2,3-dihydro-1h-indene-5-carbonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 500mg, 1g.
7-fluoro-1-oxo-2,3-dihydroindene-5-carbonitrile (CAS 1260017-98-8) is a chemical compound with the molecular formula C10H6FNO and a molecular weight of 175.16 g/mol. IUPAC name: 7-fluoro-1-oxo-2,3-dihydroindene-5-carbonitrile. InChIKey: XWMBFHIMNFDAID-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO |
|---|---|
| Molecular weight | 175.16 g/mol |
| IUPAC name | 7-fluoro-1-oxo-2,3-dihydroindene-5-carbonitrile |
| InChIKey | XWMBFHIMNFDAID-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2F)C#N |
Computed by PubChem (NCBI)