CAS 1260138-03-1 appears in our catalog under these names: Lurasidone Impurity 4, Lurasidone Impurity 8, N-(1R,2R-(2-Methylamino)cyclohex-1-yl)methyl)-N’-(1,2-benzisothiazol-3-yl)piperazine. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methanamine (CAS 1260138-03-1) is a chemical compound with the molecular formula C19H28N4S and a molecular weight of 344.5 g/mol. IUPAC name: [(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methanamine. InChIKey: ISNHCWHFMIPSEZ-HOTGVXAUSA-N.
| Molecular formula | C19H28N4S |
|---|---|
| Molecular weight | 344.5 g/mol |
| IUPAC name | [(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methanamine |
| InChIKey | ISNHCWHFMIPSEZ-HOTGVXAUSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)CN)CN2CCN(CC2)C3=NSC4=CC=CC=C43 |
Computed by PubChem (NCBI)