CAS 1260374-05-7 appears in our catalog under these names: (4-(Methoxymethoxy)-2-methylphenyl)boronic acid, 2-Methyl-4-(methoxymethoxy)phenylboronic acid, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
[4-(methoxymethoxy)-2-methylphenyl]boronic acid (CAS 1260374-05-7) is a chemical compound with the molecular formula C9H13BO4 and a molecular weight of 196.01 g/mol. IUPAC name: [4-(methoxymethoxy)-2-methylphenyl]boronic acid. InChIKey: CLCGIQQHHJUZFU-UHFFFAOYSA-N.
| Molecular formula | C9H13BO4 |
|---|---|
| Molecular weight | 196.01 g/mol |
| IUPAC name | [4-(methoxymethoxy)-2-methylphenyl]boronic acid |
| InChIKey | CLCGIQQHHJUZFU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCOC)C)(O)O |
Computed by PubChem (NCBI)