Products 1260385-95-2
CAS 1260385-95-2 is the registry number for 1-(benzenesulfonyl)-7-chloro-2-iodo-1H-pyrrolo[3,2-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
1-(benzenesulfonyl)-7-chloro-2-iodopyrrolo[3,2-b]pyridine (CAS 1260385-95-2) is a chemical compound with the molecular formula C13H8ClIN2O2S and a molecular weight of 418.64 g/mol. IUPAC name: 1-(benzenesulfonyl)-7-chloro-2-iodopyrrolo[3,2-b]pyridine. InChIKey: LOCVIHAJXHKALV-UHFFFAOYSA-N.
| Molecular formula | C13H8ClIN2O2S |
|---|---|
| Molecular weight | 418.64 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-7-chloro-2-iodopyrrolo[3,2-b]pyridine |
| InChIKey | LOCVIHAJXHKALV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=NC=CC(=C32)Cl)I |
Computed by PubChem (NCBI)