CAS 1260433-37-1 is the registry number for (2-Methyl-1,1-dioxido-2,3-dihydrobenzo[d]isothiazol-5-yl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-5-yl)boronic acid (CAS 1260433-37-1) is a chemical compound with the molecular formula C8H10BNO4S and a molecular weight of 227.05 g/mol. IUPAC name: (2-methyl-1,1-dioxo-3H-1,2-benzothiazol-5-yl)boronic acid. InChIKey: FMJPMXPIFFZHHP-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO4S |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | (2-methyl-1,1-dioxo-3H-1,2-benzothiazol-5-yl)boronic acid |
| InChIKey | FMJPMXPIFFZHHP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)S(=O)(=O)N(C2)C)(O)O |
Computed by PubChem (NCBI)