Products 1260530-25-3
CAS 1260530-25-3 appears in our catalog under these names: GSK 525768A, GSK 525768A, GSK 525768A, 99.68%, GSK525768A, 99.62%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 50mg, 25mg, 10 mg, 5 mg, 50 mg, 100 mg.
2-[(4R)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-ethylacetamide (CAS 1260530-25-3) is a chemical compound with the molecular formula C22H22ClN5O2 and a molecular weight of 423.9 g/mol. IUPAC name: 2-[(4R)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-ethylacetamide. InChIKey: AAAQFGUYHFJNHI-GOSISDBHSA-N.
| Molecular formula | C22H22ClN5O2 |
|---|---|
| Molecular weight | 423.9 g/mol |
| IUPAC name | 2-[(4R)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-ethylacetamide |
| InChIKey | AAAQFGUYHFJNHI-GOSISDBHSA-N |
| SMILES | CCNC(=O)C[C@@H]1C2=NN=C(N2C3=C(C=C(C=C3)OC)C(=N1)C4=CC=C(C=C4)Cl)C |
Computed by PubChem (NCBI)
Synonyms:
orb1709550