Products 1260586-88-6
CAS 1260586-88-6 appears in our catalog under these names: Biotin-C5-Azide, Biotin–C5–Azide, DecarboxyBiotin-N3, Biotin-C5-Azide, 98%, 98%, Biotin-C5-Azide, 98.92%. Offered by: TargetMol, GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
(3aS,4S,6aR)-4-(5-azidopentyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (CAS 1260586-88-6) is a chemical compound with the molecular formula C10H17N5OS and a molecular weight of 255.34 g/mol. IUPAC name: (3aS,4S,6aR)-4-(5-azidopentyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one. InChIKey: CSDCRNNAOYVBRW-CIUDSAMLSA-N.
| Molecular formula | C10H17N5OS |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | (3aS,4S,6aR)-4-(5-azidopentyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| InChIKey | CSDCRNNAOYVBRW-CIUDSAMLSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCCN=[N+]=[N-])NC(=O)N2 |
Computed by PubChem (NCBI)