CAS 1260587-49-2 appears in our catalog under these names: Fmoc–3–chloro–L–homophenylalanine, Fmoc-3-Cl-HoPhe-OH 95%, (2S)-4-(3-chlorophenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid, 97%, 97%, Fmoc-3-chloro-L-homophenylalanine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 5g, 25mg, 100mg.
(2S)-4-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1260587-49-2) is a chemical compound with the molecular formula C25H22ClNO4 and a molecular weight of 435.9 g/mol. IUPAC name: (2S)-4-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: CFUCQGYSVYOQID-QHCPKHFHSA-N.
| Molecular formula | C25H22ClNO4 |
|---|---|
| Molecular weight | 435.9 g/mol |
| IUPAC name | (2S)-4-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | CFUCQGYSVYOQID-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC4=CC(=CC=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)