CAS 1260593-24-5 appears in our catalog under these names: N-Fmoc-2-(trifluoromethoxy)-L-phenylalanine, 97%, Fmoc-L-Phe(2-OCF3)-OH. Offered by: AmBeed, Iris Biotech. Available pack sizes: 100mg, 1g, 50mg, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethoxy)phenyl]propanoic acid (CAS 1260593-24-5) is a chemical compound with the molecular formula C25H20F3NO5 and a molecular weight of 471.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: JTGVQWHISNNDDT-NRFANRHFSA-N.
| Molecular formula | C25H20F3NO5 |
|---|---|
| Molecular weight | 471.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | JTGVQWHISNNDDT-NRFANRHFSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)OC(F)(F)F |
Computed by PubChem (NCBI)