CAS 1260608-62-5 appears in our catalog under these names: Fmoc-4-Cl-HoPhe-OH, 95%, N–Fmoc–4–chloro–L–homophenylalanine, Fmoc-4-Cl-HoPhe-OH 95%, (αS)-4-Chloro-α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid, 95%, 95%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 50mg, 25mg, 100mg, 250mg, 1g, 5g.
(2S)-4-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1260608-62-5) is a chemical compound with the molecular formula C25H22ClNO4 and a molecular weight of 435.9 g/mol. IUPAC name: (2S)-4-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: CMSUCSRQQQVXJJ-QHCPKHFHSA-N.
| Molecular formula | C25H22ClNO4 |
|---|---|
| Molecular weight | 435.9 g/mol |
| IUPAC name | (2S)-4-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | CMSUCSRQQQVXJJ-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC4=CC=C(C=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)