CAS 1260619-43-9 is the registry number for N-Acetyl-S-(2-carboxyethyl)-L-cysteine-d3. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(2R)-3-(2-carboxyethylsulfanyl)-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid (CAS 1260619-43-9) is a chemical compound with the molecular formula C8H13NO5S and a molecular weight of 238.28 g/mol. IUPAC name: (2R)-3-(2-carboxyethylsulfanyl)-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid. InChIKey: CLQPFBSYILTXKI-FYFSCIFKSA-N.
| Molecular formula | C8H13NO5S |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (2R)-3-(2-carboxyethylsulfanyl)-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
| InChIKey | CLQPFBSYILTXKI-FYFSCIFKSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H](CSCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)