Products 1260666-80-5
CAS 1260666-80-5 appears in our catalog under these names: 5–Fluoroisoindolin–1–one, 5-Fluoroisoindolin-1-one 98%, 5-Fluoroisoindolin-1-one, 98%, 5-Fluoroisoindolin-1-one, 98%, 98%, 5-Fluoro-2,3-dihydroisoindol-1-one, 98%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g, 10g.
5-fluoro-2,3-dihydroisoindol-1-one (CAS 1260666-80-5) is a chemical compound with the molecular formula C8H6FNO and a molecular weight of 151.14 g/mol. IUPAC name: 5-fluoro-2,3-dihydroisoindol-1-one. InChIKey: NKCDELXKANYEQE-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO |
|---|---|
| Molecular weight | 151.14 g/mol |
| IUPAC name | 5-fluoro-2,3-dihydroisoindol-1-one |
| InChIKey | NKCDELXKANYEQE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)F)C(=O)N1 |
Computed by PubChem (NCBI)